C20H20F3N3O4 — CID 176841723
5-(1-tert-butyl-2,2,4,4-tetradeuterioazetidin-3-yl)-2-[(3R)-2,6-dioxopiperidin-3-yl]-4,6,7-trifluoroisoindole-1,3-dione (PubChem CID 176841723) has the molecular formula C20H20F3N3O4 and a molecular weight of 427.42 g/mol. Its IUPAC name is 5-(1-tert-butyl-2,2,4,4-tetradeuterioazetidin-3-yl)-2-[(3R)-2,6-dioxopiperidin-3-yl]-4,6,7-trifluoroisoindole-1,3-dione.
| Compound Name | 5-(1-tert-butyl-2,2,4,4-tetradeuterioazetidin-3-yl)-2-[(3R)-2,6-dioxopiperidin-3-yl]-4,6,7-trifluoroisoindole-1,3-dione |
|---|---|
| PubChem CID | 176841723 |
| Molecular Formula | C20H20F3N3O4 |
| Molecular Weight | 427.42 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 5-(1-tert-butyl-2,2,4,4-tetradeuterioazetidin-3-yl)-2-[(3R)-2,6-dioxopiperidin-3-yl]-4,6,7-trifluoroisoindole-1,3-dione |
| SMILES | [2H]C1([2H])C(c2c(F)c(F)c3c(c2F)C(=O)N([C@@H]2CCC(=O)NC2=O)C3=O)C([2H])([2H])N1C(C)(C)C |
| InChI | InChI=1S/C20H20F3N3O4/c1-20(2,3)25-6-8(7-25)11-14(21)12-13(16(23)15(11)22)19(30)26(18(12)29)9-4-5-10(27)24-17(9)28/h8-9H,4-7H2,1-3H3,(H,24,27,28)/t9-/m1/s1/i6D2,7D2 |
| InChIKey | NCONCRBSDKTSQJ-KNCZLBMMSA-N |
| XLogP | 1.70 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|