C20H22FN3O5 — CID 167913713
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-4-[3-[(2-methylpropan-2-yl)oxy]azetidin-1-yl]isoindole-1,3-dione (PubChem CID 167913713) has the molecular formula C20H22FN3O5 and a molecular weight of 403.41 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-4-[3-[(2-methylpropan-2-yl)oxy]azetidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-4-[3-[(2-methylpropan-2-yl)oxy]azetidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 167913713 |
| Molecular Formula | C20H22FN3O5 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-4-[3-[(2-methylpropan-2-yl)oxy]azetidin-1-yl]isoindole-1,3-dione |
| SMILES | CC(C)(C)OC1CN(c2c(F)ccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C20H22FN3O5/c1-20(2,3)29-10-8-23(9-10)16-12(21)5-4-11-15(16)19(28)24(18(11)27)13-6-7-14(25)22-17(13)26/h4-5,10,13H,6-9H2,1-3H3,(H,22,25,26) |
| InChIKey | SIRWVESCLALRPJ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|