C22H24FN3O5 — CID 167925993
2-(2,6-dioxopiperidin-3-yl)-5-fluoro-4-(5-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)isoindole-1,3-dione (PubChem CID 167925993) has the molecular formula C22H24FN3O5 and a molecular weight of 429.45 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-4-(5-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-4-(5-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167925993 |
| Molecular Formula | C22H24FN3O5 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-4-(5-hydroxy-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(F)c(N4CCC5C(O)CCCC5C4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C22H24FN3O5/c23-14-5-4-13-18(19(14)25-9-8-12-11(10-25)2-1-3-16(12)27)22(31)26(21(13)30)15-6-7-17(28)24-20(15)29/h4-5,11-12,15-16,27H,1-3,6-10H2,(H,24,28,29) |
| InChIKey | RDGGDRCGUCFEFA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 107.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|