C19H19FN2O5 — CID 175628192
2-(2,6-dioxopiperidin-3-yl)-4-fluoro-5-(1-hydroxycyclohexyl)isoindole-1,3-dione (PubChem CID 175628192) has the molecular formula C19H19FN2O5 and a molecular weight of 374.37 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-fluoro-5-(1-hydroxycyclohexyl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-fluoro-5-(1-hydroxycyclohexyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 175628192 |
| Molecular Formula | C19H19FN2O5 |
| Molecular Weight | 374.37 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-fluoro-5-(1-hydroxycyclohexyl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(C4(O)CCCCC4)c(F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C19H19FN2O5/c20-15-11(19(27)8-2-1-3-9-19)5-4-10-14(15)18(26)22(17(10)25)12-6-7-13(23)21-16(12)24/h4-5,12,27H,1-3,6-9H2,(H,21,23,24) |
| InChIKey | YEZXSKOAZGGXLG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|