C18H17N3O6 — CID 134413856
(3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carboxylic acid (PubChem CID 134413856) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is (3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 134413856 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (3R)-1-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]pyrrolidine-3-carboxylic acid |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CC[C@@H](C(=O)O)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H17N3O6/c22-14-4-3-13(15(23)19-14)21-16(24)11-2-1-10(7-12(11)17(21)25)20-6-5-9(8-20)18(26)27/h1-2,7,9,13H,3-6,8H2,(H,26,27)(H,19,22,23)/t9-,13?/m1/s1 |
| InChIKey | RUCCDOWQVDUZAC-CGCSKFHYSA-N |
| XLogP | -0.00 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|