C26H24N4O7 — CID 162482554
4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methylpiperazine-1-carbonyl]benzoic acid (PubChem CID 162482554) has the molecular formula C26H24N4O7 and a molecular weight of 504.50 g/mol. Its IUPAC name is 4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methylpiperazine-1-carbonyl]benzoic acid.
| Compound Name | 4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methylpiperazine-1-carbonyl]benzoic acid |
|---|---|
| PubChem CID | 162482554 |
| Molecular Formula | C26H24N4O7 |
| Molecular Weight | 504.50 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 4-[4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-methylpiperazine-1-carbonyl]benzoic acid |
| SMILES | CC1CN(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CCN1C(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C26H24N4O7/c1-14-13-28(10-11-29(14)23(33)15-2-4-16(5-3-15)26(36)37)17-6-7-18-19(12-17)25(35)30(24(18)34)20-8-9-21(31)27-22(20)32/h2-7,12,14,20H,8-11,13H2,1H3,(H,36,37)(H,27,31,32) |
| InChIKey | WCWYVJHLRAKHJT-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.50 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|