C22H24N4O7 — CID 175094925
2-tert-butyl-4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-oxopiperazine-1-carboxylic acid (PubChem CID 175094925) has the molecular formula C22H24N4O7 and a molecular weight of 456.46 g/mol. Its IUPAC name is 2-tert-butyl-4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-oxopiperazine-1-carboxylic acid.
| Compound Name | 2-tert-butyl-4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-oxopiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 175094925 |
| Molecular Formula | C22H24N4O7 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 2-tert-butyl-4-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-3-oxopiperazine-1-carboxylic acid |
| SMILES | CC(C)(C)C1C(=O)N(c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)CCN1C(=O)O |
| InChI | InChI=1S/C22H24N4O7/c1-22(2,3)16-20(31)24(8-9-25(16)21(32)33)11-4-5-12-13(10-11)19(30)26(18(12)29)14-6-7-15(27)23-17(14)28/h4-5,10,14,16H,6-9H2,1-3H3,(H,32,33)(H,23,27,28) |
| InChIKey | QMUONBSMXSFIEK-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|