C17H16IN3O4 — CID 155177559
2-(2,6-dioxopiperidin-3-yl)-5-(3-iodopyrrolidin-1-yl)isoindole-1,3-dione (PubChem CID 155177559) has the molecular formula C17H16IN3O4 and a molecular weight of 453.24 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-5-(3-iodopyrrolidin-1-yl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-5-(3-iodopyrrolidin-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 155177559 |
| Molecular Formula | C17H16IN3O4 |
| Molecular Weight | 453.24 g/mol |
| Exact Mass | 453.02 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-(3-iodopyrrolidin-1-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3ccc(N4CCC(I)C4)cc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C17H16IN3O4/c18-9-5-6-20(8-9)10-1-2-11-12(7-10)17(25)21(16(11)24)13-3-4-14(22)19-15(13)23/h1-2,7,9,13H,3-6,8H2,(H,19,22,23) |
| InChIKey | ULRHCPARSHZAFT-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.24 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|