C21H26F2N4O3 — CID 176841558
(3R)-3-[6-(4-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-5,7-difluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 176841558) has the molecular formula C21H26F2N4O3 and a molecular weight of 428.51 g/mol. Its IUPAC name is (3R)-3-[6-(4-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-5,7-difluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[6-(4-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-5,7-difluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 176841558 |
| Molecular Formula | C21H26F2N4O3 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | (3R)-3-[6-(4-tert-butyl-2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-5,7-difluoro-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | [2H]C1([2H])N(c2c(F)cc3c(c2F)CN([C@@H]2CCC(=O)NC2=O)C3=O)C([2H])([2H])C([2H])([2H])N(C(C)(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C21H26F2N4O3/c1-21(2,3)26-8-6-25(7-9-26)18-14(22)10-12-13(17(18)23)11-27(20(12)30)15-4-5-16(28)24-19(15)29/h10,15H,4-9,11H2,1-3H3,(H,24,28,29)/t15-/m1/s1/i6D2,7D2,8D2,9D2 |
| InChIKey | SUUHZQANNUZQRF-AGTGGSQKSA-N |
| XLogP | 1.65 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|