C20H26F2N4O3 — CID 171786471
3-[5,7-difluoro-6-(4-methylpiperazin-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;ethane (PubChem CID 171786471) has the molecular formula C20H26F2N4O3 and a molecular weight of 408.45 g/mol. Its IUPAC name is 3-[5,7-difluoro-6-(4-methylpiperazin-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;ethane.
| Compound Name | 3-[5,7-difluoro-6-(4-methylpiperazin-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;ethane |
|---|---|
| PubChem CID | 171786471 |
| Molecular Formula | C20H26F2N4O3 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 3-[5,7-difluoro-6-(4-methylpiperazin-1-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione;ethane |
| SMILES | CC.CN1CCN(c2c(F)cc3c(c2F)CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C18H20F2N4O3.C2H6/c1-22-4-6-23(7-5-22)16-12(19)8-10-11(15(16)20)9-24(18(10)27)13-2-3-14(25)21-17(13)26;1-2/h8,13H,2-7,9H2,1H3,(H,21,25,26);1-2H3 |
| InChIKey | UDIIIANRBUSWDF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|