C13H10FIN2O3 — CID 134348219
3-(4-fluoro-7-iodo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 134348219) has the molecular formula C13H10FIN2O3 and a molecular weight of 388.14 g/mol. Its IUPAC name is 3-(4-fluoro-7-iodo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-fluoro-7-iodo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 134348219 |
| Molecular Formula | C13H10FIN2O3 |
| Molecular Weight | 388.14 g/mol |
| Exact Mass | 387.97 |
| IUPAC Name | 3-(4-fluoro-7-iodo-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(I)ccc(F)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C13H10FIN2O3/c14-7-1-2-8(15)6-5-17(13(20)11(6)7)9-3-4-10(18)16-12(9)19/h1-2,9H,3-5H2,(H,16,18,19) |
| InChIKey | GGWKOZASCXQDTF-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.14 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|