C21H16FN3O3 — CID 166423081
3-[7-(7-fluoro-1H-indol-4-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166423081) has the molecular formula C21H16FN3O3 and a molecular weight of 377.38 g/mol. Its IUPAC name is 3-[7-(7-fluoro-1H-indol-4-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(7-fluoro-1H-indol-4-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166423081 |
| Molecular Formula | C21H16FN3O3 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 3-[7-(7-fluoro-1H-indol-4-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cccc3-c3ccc(F)c4[nH]ccc34)C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H16FN3O3/c22-16-5-4-12(13-8-9-23-19(13)16)11-2-1-3-14-15(11)10-25(21(14)28)17-6-7-18(26)24-20(17)27/h1-5,8-9,17,23H,6-7,10H2,(H,24,26,27) |
| InChIKey | ZWUAVDHZFDDGRC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|