C18H19N3O3 — CID 166416358
3-[3-oxo-7-(1,2,3,6-tetrahydropyridin-5-yl)-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166416358) has the molecular formula C18H19N3O3 and a molecular weight of 325.37 g/mol. Its IUPAC name is 3-[3-oxo-7-(1,2,3,6-tetrahydropyridin-5-yl)-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-(1,2,3,6-tetrahydropyridin-5-yl)-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166416358 |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-[3-oxo-7-(1,2,3,6-tetrahydropyridin-5-yl)-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cccc3C3=CCCNC3)C2=O)C(=O)N1 |
| InChI | InChI=1S/C18H19N3O3/c22-16-7-6-15(17(23)20-16)21-10-14-12(11-3-2-8-19-9-11)4-1-5-13(14)18(21)24/h1,3-5,15,19H,2,6-10H2,(H,20,22,23) |
| InChIKey | MFAWJOZVNNWQCV-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|