C21H17N3O3 — CID 166423087
3-[7-(1H-indol-7-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166423087) has the molecular formula C21H17N3O3 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-[7-(1H-indol-7-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(1H-indol-7-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166423087 |
| Molecular Formula | C21H17N3O3 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-[7-(1H-indol-7-yl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(cccc3-c3cccc4cc[nH]c34)C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H17N3O3/c25-18-8-7-17(20(26)23-18)24-11-16-13(4-2-6-15(16)21(24)27)14-5-1-3-12-9-10-22-19(12)14/h1-6,9-10,17,22H,7-8,11H2,(H,23,25,26) |
| InChIKey | ZSBQSPSMZZPRTA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|