C14H15N3O5S — CID 69327564
3-[7-(aminomethylsulfonyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 69327564) has the molecular formula C14H15N3O5S and a molecular weight of 337.36 g/mol. Its IUPAC name is 3-[7-(aminomethylsulfonyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(aminomethylsulfonyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 69327564 |
| Molecular Formula | C14H15N3O5S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-[7-(aminomethylsulfonyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | NCS(=O)(=O)c1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H15N3O5S/c15-7-23(21,22)11-3-1-2-8-9(11)6-17(14(8)20)10-4-5-12(18)16-13(10)19/h1-3,10H,4-7,15H2,(H,16,18,19) |
| InChIKey | MAMYINXOOKRLBM-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|