C23H24N2O8S2 — CID 150838314
3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfonyl]propyl 4-methylbenzenesulfonate (PubChem CID 150838314) has the molecular formula C23H24N2O8S2 and a molecular weight of 520.59 g/mol. Its IUPAC name is 3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfonyl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfonyl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 150838314 |
| Molecular Formula | C23H24N2O8S2 |
| Molecular Weight | 520.59 g/mol |
| Exact Mass | 520.10 |
| IUPAC Name | 3-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfonyl]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCS(=O)(=O)c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C23H24N2O8S2/c1-15-6-8-16(9-7-15)35(31,32)33-12-3-13-34(29,30)20-5-2-4-17-18(20)14-25(23(17)28)19-10-11-21(26)24-22(19)27/h2,4-9,19H,3,10-14H2,1H3,(H,24,26,27) |
| InChIKey | KNLLCTAWHBSEBD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 143.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.59 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|