C24H26N2O7S2 — CID 175205343
ethyl 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]ethoxy]-4-methylbenzenesulfonate (PubChem CID 175205343) has the molecular formula C24H26N2O7S2 and a molecular weight of 518.61 g/mol. Its IUPAC name is ethyl 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]ethoxy]-4-methylbenzenesulfonate.
| Compound Name | ethyl 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]ethoxy]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 175205343 |
| Molecular Formula | C24H26N2O7S2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | ethyl 2-[2-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]ethoxy]-4-methylbenzenesulfonate |
| SMILES | CCOS(=O)(=O)c1ccc(C)cc1OCCSc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H26N2O7S2/c1-3-33-35(30,31)21-9-7-15(2)13-19(21)32-11-12-34-20-6-4-5-16-17(20)14-26(24(16)29)18-8-10-22(27)25-23(18)28/h4-7,9,13,18H,3,8,10-12,14H2,1-2H3,(H,25,27,28) |
| InChIKey | AQEUTXHJVQVHFK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|