C24H36ClN3O3S — CID 162427147
8-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]octyl-trimethylazanium chloride (PubChem CID 162427147) has the molecular formula C24H36ClN3O3S and a molecular weight of 482.09 g/mol. Its IUPAC name is 8-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]octyl-trimethylazanium chloride.
| Compound Name | 8-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]octyl-trimethylazanium chloride |
|---|---|
| PubChem CID | 162427147 |
| Molecular Formula | C24H36ClN3O3S |
| Molecular Weight | 482.09 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | 8-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]octyl-trimethylazanium chloride |
| SMILES | C[N+](C)(C)CCCCCCCCSc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O.[Cl-] |
| InChI | InChI=1S/C24H35N3O3S.ClH/c1-27(2,3)15-8-6-4-5-7-9-16-31-21-12-10-11-18-19(21)17-26(24(18)30)20-13-14-22(28)25-23(20)29;/h10-12,20H,4-9,13-17H2,1-3H3;1H |
| InChIKey | ZNVWDASYRUZOMF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.09 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|