C26H37N3O3S — CID 154689383
3-[7-[6-(cyclohexylmethylamino)hexylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689383) has the molecular formula C26H37N3O3S and a molecular weight of 471.67 g/mol. Its IUPAC name is 3-[7-[6-(cyclohexylmethylamino)hexylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[6-(cyclohexylmethylamino)hexylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689383 |
| Molecular Formula | C26H37N3O3S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | 3-[7-[6-(cyclohexylmethylamino)hexylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCCCCCCNCC4CCCCC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H37N3O3S/c30-24-14-13-22(25(31)28-24)29-18-21-20(26(29)32)11-8-12-23(21)33-16-7-2-1-6-15-27-17-19-9-4-3-5-10-19/h8,11-12,19,22,27H,1-7,9-10,13-18H2,(H,28,30,31) |
| InChIKey | VIVYTYVMAZEOCL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|