C27H39N3O3S — CID 154689925
3-[7-[7-(azocan-1-yl)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689925) has the molecular formula C27H39N3O3S and a molecular weight of 485.69 g/mol. Its IUPAC name is 3-[7-[7-(azocan-1-yl)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[7-(azocan-1-yl)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689925 |
| Molecular Formula | C27H39N3O3S |
| Molecular Weight | 485.69 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 3-[7-[7-(azocan-1-yl)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCCCCCCCN4CCCCCCC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H39N3O3S/c31-25-15-14-23(26(32)28-25)30-20-22-21(27(30)33)12-11-13-24(22)34-19-10-6-2-5-9-18-29-16-7-3-1-4-8-17-29/h11-13,23H,1-10,14-20H2,(H,28,31,32) |
| InChIKey | YDPBJMZEHFWTBO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.69 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|