C27H31FN4O3S — CID 155665381
3-[7-[7-(3-fluoro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 155665381) has the molecular formula C27H31FN4O3S and a molecular weight of 510.64 g/mol. Its IUPAC name is 3-[7-[7-(3-fluoro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[7-(3-fluoro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155665381 |
| Molecular Formula | C27H31FN4O3S |
| Molecular Weight | 510.64 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | 3-[7-[7-(3-fluoro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCCCCCCCN4Cc5cc(F)cnc5C4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H31FN4O3S/c28-19-13-18-15-31(17-22(18)29-14-19)11-4-2-1-3-5-12-36-24-8-6-7-20-21(24)16-32(27(20)35)23-9-10-25(33)30-26(23)34/h6-8,13-14,23H,1-5,9-12,15-17H2,(H,30,33,34) |
| InChIKey | DEGKPWGIDOGRPU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.64 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|