C26H35F2N3O3S — CID 154689942
3-[7-[8-(4,4-difluoropiperidin-1-yl)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689942) has the molecular formula C26H35F2N3O3S and a molecular weight of 507.65 g/mol. Its IUPAC name is 3-[7-[8-(4,4-difluoropiperidin-1-yl)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[8-(4,4-difluoropiperidin-1-yl)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689942 |
| Molecular Formula | C26H35F2N3O3S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 3-[7-[8-(4,4-difluoropiperidin-1-yl)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCCCCCCCCN4CCC(F)(F)CC4)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C26H35F2N3O3S/c27-26(28)12-15-30(16-13-26)14-5-3-1-2-4-6-17-35-22-9-7-8-19-20(22)18-31(25(19)34)21-10-11-23(32)29-24(21)33/h7-9,21H,1-6,10-18H2,(H,29,32,33) |
| InChIKey | ZRNBQCBAJLJLDG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|