C28H38F2N2O3S — CID 164962545
3-[7-[8-(3,3-difluoro-5-methylcyclohexyl)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 164962545) has the molecular formula C28H38F2N2O3S and a molecular weight of 520.69 g/mol. Its IUPAC name is 3-[7-[8-(3,3-difluoro-5-methylcyclohexyl)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[8-(3,3-difluoro-5-methylcyclohexyl)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 164962545 |
| Molecular Formula | C28H38F2N2O3S |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | 3-[7-[8-(3,3-difluoro-5-methylcyclohexyl)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1CC(CCCCCCCCSc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)CC(F)(F)C1 |
| InChI | InChI=1S/C28H38F2N2O3S/c1-19-15-20(17-28(29,30)16-19)9-6-4-2-3-5-7-14-36-24-11-8-10-21-22(24)18-32(27(21)35)23-12-13-25(33)31-26(23)34/h8,10-11,19-20,23H,2-7,9,12-18H2,1H3,(H,31,33,34) |
| InChIKey | PPRSOHXNKIQXSY-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|