C32H47N3O3S — CID 166921094
3-[7-[7-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methylamino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166921094) has the molecular formula C32H47N3O3S and a molecular weight of 553.81 g/mol. Its IUPAC name is 3-[7-[7-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methylamino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[7-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methylamino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166921094 |
| Molecular Formula | C32H47N3O3S |
| Molecular Weight | 553.81 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | 3-[7-[7-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methylamino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1CC2CC(C1)CC(C)(CNCCCCCCCSc1cccc3c1CN(C1CCC(=O)NC1=O)C3=O)C2 |
| InChI | InChI=1S/C32H47N3O3S/c1-22-15-23-17-24(16-22)19-32(2,18-23)21-33-13-6-4-3-5-7-14-39-28-10-8-9-25-26(28)20-35(31(25)38)27-11-12-29(36)34-30(27)37/h8-10,22-24,27,33H,3-7,11-21H2,1-2H3,(H,34,36,37) |
| InChIKey | HMBQWQPDWIRQPT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|