C28H41N3O3S — CID 154689843
3-[7-[7-[(4,4-dimethylcyclohexyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689843) has the molecular formula C28H41N3O3S and a molecular weight of 499.72 g/mol. Its IUPAC name is 3-[7-[7-[(4,4-dimethylcyclohexyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[7-[(4,4-dimethylcyclohexyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689843 |
| Molecular Formula | C28H41N3O3S |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | 3-[7-[7-[(4,4-dimethylcyclohexyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1(C)CCC(NCCCCCCCSc2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)CC1 |
| InChI | InChI=1S/C28H41N3O3S/c1-28(2)15-13-20(14-16-28)29-17-6-4-3-5-7-18-35-24-10-8-9-21-22(24)19-31(27(21)34)23-11-12-25(32)30-26(23)33/h8-10,20,23,29H,3-7,11-19H2,1-2H3,(H,30,32,33) |
| InChIKey | GUUJAWFISIWCPG-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|