C29H45N3O3S — CID 166921362
3-[7-[8-(2,2-dimethylhexan-3-ylamino)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166921362) has the molecular formula C29H45N3O3S and a molecular weight of 515.76 g/mol. Its IUPAC name is 3-[7-[8-(2,2-dimethylhexan-3-ylamino)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[8-(2,2-dimethylhexan-3-ylamino)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166921362 |
| Molecular Formula | C29H45N3O3S |
| Molecular Weight | 515.76 g/mol |
| Exact Mass | 515.32 |
| IUPAC Name | 3-[7-[8-(2,2-dimethylhexan-3-ylamino)octylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCCC(NCCCCCCCCSc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O)C(C)(C)C |
| InChI | InChI=1S/C29H45N3O3S/c1-5-13-25(29(2,3)4)30-18-10-8-6-7-9-11-19-36-24-15-12-14-21-22(24)20-32(28(21)35)23-16-17-26(33)31-27(23)34/h12,14-15,23,25,30H,5-11,13,16-20H2,1-4H3,(H,31,33,34) |
| InChIKey | LOEDQUJZKGWWQV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.76 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|