C30H45N3O3S — CID 167062750
3-[7-[7-[(4-ethyl-2-methylhept-1-en-4-yl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167062750) has the molecular formula C30H45N3O3S and a molecular weight of 527.78 g/mol. Its IUPAC name is 3-[7-[7-[(4-ethyl-2-methylhept-1-en-4-yl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[7-[(4-ethyl-2-methylhept-1-en-4-yl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167062750 |
| Molecular Formula | C30H45N3O3S |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | 3-[7-[7-[(4-ethyl-2-methylhept-1-en-4-yl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C=C(C)CC(CC)(CCC)NCCCCCCCSc1cccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C30H45N3O3S/c1-5-17-30(6-2,20-22(3)4)31-18-10-8-7-9-11-19-37-26-14-12-13-23-24(26)21-33(29(23)36)25-15-16-27(34)32-28(25)35/h12-14,25,31H,3,5-11,15-21H2,1-2,4H3,(H,32,34,35) |
| InChIKey | WJBFSHBPVOCSJH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|