C28H35N3O3S — CID 166921416
3-[3-oxo-7-[6-(1-tetracyclo[3.3.1.03,9.07,9]nonanylamino)hexylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166921416) has the molecular formula C28H35N3O3S and a molecular weight of 493.67 g/mol. Its IUPAC name is 3-[3-oxo-7-[6-(1-tetracyclo[3.3.1.03,9.07,9]nonanylamino)hexylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[6-(1-tetracyclo[3.3.1.03,9.07,9]nonanylamino)hexylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166921416 |
| Molecular Formula | C28H35N3O3S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 3-[3-oxo-7-[6-(1-tetracyclo[3.3.1.03,9.07,9]nonanylamino)hexylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCCCCCCNC45CC6CC7CC(C4)C765)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H35N3O3S/c32-24-9-8-22(25(33)30-24)31-16-21-20(26(31)34)6-5-7-23(21)35-11-4-2-1-3-10-29-27-14-18-12-17-13-19(15-27)28(17,18)27/h5-7,17-19,22,29H,1-4,8-16H2,(H,30,32,33) |
| InChIKey | HNJYUBUKMNNXEU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|