C30H39N3O4S — CID 166921237
3-[7-[7-[(3-hydroxy-1-tetracyclo[5.2.1.03,8.05,8]decanyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166921237) has the molecular formula C30H39N3O4S and a molecular weight of 537.73 g/mol. Its IUPAC name is 3-[7-[7-[(3-hydroxy-1-tetracyclo[5.2.1.03,8.05,8]decanyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[7-[(3-hydroxy-1-tetracyclo[5.2.1.03,8.05,8]decanyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166921237 |
| Molecular Formula | C30H39N3O4S |
| Molecular Weight | 537.73 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | 3-[7-[7-[(3-hydroxy-1-tetracyclo[5.2.1.03,8.05,8]decanyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3c(SCCCCCCCNC45CC6CC7CC(O)(C4)C67C5)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H39N3O4S/c34-25-10-9-23(26(35)32-25)33-16-22-21(27(33)36)7-6-8-24(22)38-12-5-3-1-2-4-11-31-28-14-19-13-20-15-29(37,17-28)30(19,20)18-28/h6-8,19-20,23,31,37H,1-5,9-18H2,(H,32,34,35) |
| InChIKey | HLXPWYOZOCXCHG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.73 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|