C30H40N4O4S — CID 155665366
1-(1-adamantyl)-3-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]hexyl]urea (PubChem CID 155665366) has the molecular formula C30H40N4O4S and a molecular weight of 552.74 g/mol. Its IUPAC name is 1-(1-adamantyl)-3-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]hexyl]urea.
| Compound Name | 1-(1-adamantyl)-3-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]hexyl]urea |
|---|---|
| PubChem CID | 155665366 |
| Molecular Formula | C30H40N4O4S |
| Molecular Weight | 552.74 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 1-(1-adamantyl)-3-[6-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfanyl]hexyl]urea |
| SMILES | O=C1CCC(N2Cc3c(SCCCCCCNC(=O)NC45CC6CC(CC(C6)C4)C5)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H40N4O4S/c35-26-9-8-24(27(36)32-26)34-18-23-22(28(34)37)6-5-7-25(23)39-11-4-2-1-3-10-31-29(38)33-30-15-19-12-20(16-30)14-21(13-19)17-30/h5-7,19-21,24H,1-4,8-18H2,(H2,31,33,38)(H,32,35,36) |
| InChIKey | IHZQDIUQNQZBCX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.74 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|