C29H39N3O3S — CID 154689915
3-[3-oxo-7-[5-[(2,2,6-trimethyl-5-tricyclo[4.2.0.01,3]octanyl)amino]pentylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 154689915) has the molecular formula C29H39N3O3S and a molecular weight of 509.72 g/mol. Its IUPAC name is 3-[3-oxo-7-[5-[(2,2,6-trimethyl-5-tricyclo[4.2.0.01,3]octanyl)amino]pentylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[5-[(2,2,6-trimethyl-5-tricyclo[4.2.0.01,3]octanyl)amino]pentylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154689915 |
| Molecular Formula | C29H39N3O3S |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 3-[3-oxo-7-[5-[(2,2,6-trimethyl-5-tricyclo[4.2.0.01,3]octanyl)amino]pentylsulfanyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1(C)C2CC(NCCCCCSc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)C3(C)CCC213 |
| InChI | InChI=1S/C29H39N3O3S/c1-27(2)22-16-23(28(3)12-13-29(22,27)28)30-14-5-4-6-15-36-21-9-7-8-18-19(21)17-32(26(18)35)20-10-11-24(33)31-25(20)34/h7-9,20,22-23,30H,4-6,10-17H2,1-3H3,(H,31,33,34) |
| InChIKey | LVDCGOKYFSCYHP-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|