C31H45N3O3S — CID 166921413
3-[7-[7-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 166921413) has the molecular formula C31H45N3O3S and a molecular weight of 539.79 g/mol. Its IUPAC name is 3-[7-[7-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-[7-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 166921413 |
| Molecular Formula | C31H45N3O3S |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | 3-[7-[7-[(3,7-dimethyl-2-bicyclo[3.3.1]nonanyl)amino]heptylsulfanyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1CC2CC(C)C(NCCCCCCCSc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)C(C1)C2 |
| InChI | InChI=1S/C31H45N3O3S/c1-20-15-22-17-21(2)29(23(16-20)18-22)32-13-6-4-3-5-7-14-38-27-10-8-9-24-25(27)19-34(31(24)37)26-11-12-28(35)33-30(26)36/h8-10,20-23,26,29,32H,3-7,11-19H2,1-2H3,(H,33,35,36) |
| InChIKey | PHAYFSDFMMUFDJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|