C31H44N4O4 — CID 167279947
4-[6-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methylamino]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 167279947) has the molecular formula C31H44N4O4 and a molecular weight of 536.72 g/mol. Its IUPAC name is 4-[6-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methylamino]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[6-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methylamino]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 167279947 |
| Molecular Formula | C31H44N4O4 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | 4-[6-[(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)methylamino]hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CC1CC2CC(C1)CC(C)(CNCCCCCCNc1cccc3c1C(=O)N(C1CCC(=O)NC1=O)C3=O)C2 |
| InChI | InChI=1S/C31H44N4O4/c1-20-14-21-16-22(15-20)18-31(2,17-21)19-32-12-5-3-4-6-13-33-24-9-7-8-23-27(24)30(39)35(29(23)38)25-10-11-26(36)34-28(25)37/h7-9,20-22,25,32-33H,3-6,10-19H2,1-2H3,(H,34,36,37) |
| InChIKey | SHYOUTHIEOQZAT-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|