C30H40N4O4 — CID 156788871
4-[6-(1-adamantylmethylamino)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 156788871) has the molecular formula C30H40N4O4 and a molecular weight of 520.67 g/mol. Its IUPAC name is 4-[6-(1-adamantylmethylamino)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[6-(1-adamantylmethylamino)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 156788871 |
| Molecular Formula | C30H40N4O4 |
| Molecular Weight | 520.67 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | 4-[6-(1-adamantylmethylamino)hexylamino]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(NCCCCCCNCC45CC6CC(CC(C6)C4)C5)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C30H40N4O4/c35-25-9-8-24(27(36)33-25)34-28(37)22-6-5-7-23(26(22)29(34)38)32-11-4-2-1-3-10-31-18-30-15-19-12-20(16-30)14-21(13-19)17-30/h5-7,19-21,24,31-32H,1-4,8-18H2,(H,33,35,36) |
| InChIKey | YCACLHKIPTZPDU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|