C33H44N4O7 — CID 155514707
2-(1-adamantyl)-N-[3-[2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxy]ethoxy]propyl]acetamide (PubChem CID 155514707) has the molecular formula C33H44N4O7 and a molecular weight of 608.74 g/mol. Its IUPAC name is 2-(1-adamantyl)-N-[3-[2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxy]ethoxy]propyl]acetamide.
| Compound Name | 2-(1-adamantyl)-N-[3-[2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxy]ethoxy]propyl]acetamide |
|---|---|
| PubChem CID | 155514707 |
| Molecular Formula | C33H44N4O7 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | 2-(1-adamantyl)-N-[3-[2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxy]ethoxy]propyl]acetamide |
| SMILES | O=C(CC12CC3CC(CC(C3)C1)C2)NCCCOCCOCCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C33H44N4O7/c38-27-7-6-26(30(40)36-27)37-31(41)24-4-1-5-25(29(24)32(37)42)34-8-2-10-43-12-13-44-11-3-9-35-28(39)20-33-17-21-14-22(18-33)16-23(15-21)19-33/h1,4-5,21-23,26,34H,2-3,6-20H2,(H,35,39)(H,36,38,40) |
| InChIKey | OCEADRRXDVSTSC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|