C27H32N2O6S — CID 169092376
7-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]heptyl 4-methylbenzenesulfonate (PubChem CID 169092376) has the molecular formula C27H32N2O6S and a molecular weight of 512.63 g/mol. Its IUPAC name is 7-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]heptyl 4-methylbenzenesulfonate.
| Compound Name | 7-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]heptyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 169092376 |
| Molecular Formula | C27H32N2O6S |
| Molecular Weight | 512.63 g/mol |
| Exact Mass | 512.20 |
| IUPAC Name | 7-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]heptyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCCc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)cc1 |
| InChI | InChI=1S/C27H32N2O6S/c1-19-8-12-22(13-9-19)36(33,34)35-16-6-4-2-3-5-7-20-10-11-21-18-29(27(32)23(21)17-20)24-14-15-25(30)28-26(24)31/h8-13,17,24H,2-7,14-16,18H2,1H3,(H,28,30,31) |
| InChIKey | LKHLCSPTOAPTGO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.63 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|