C21H19FN2O5S — CID 167604449
3-[5-[(2-fluoro-5-methylphenyl)sulfonylmethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167604449) has the molecular formula C21H19FN2O5S and a molecular weight of 430.46 g/mol. Its IUPAC name is 3-[5-[(2-fluoro-5-methylphenyl)sulfonylmethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[5-[(2-fluoro-5-methylphenyl)sulfonylmethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167604449 |
| Molecular Formula | C21H19FN2O5S |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 3-[5-[(2-fluoro-5-methylphenyl)sulfonylmethyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1ccc(F)c(S(=O)(=O)Cc2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3)c1 |
| InChI | InChI=1S/C21H19FN2O5S/c1-12-2-5-16(22)18(8-12)30(28,29)11-13-3-4-14-10-24(21(27)15(14)9-13)17-6-7-19(25)23-20(17)26/h2-5,8-9,17H,6-7,10-11H2,1H3,(H,23,25,26) |
| InChIKey | KENNTIAKGFLNMG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|