C24H26N2O7S2 — CID 150014079
4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfinyl]butyl 4-methylbenzenesulfonate (PubChem CID 150014079) has the molecular formula C24H26N2O7S2 and a molecular weight of 518.61 g/mol. Its IUPAC name is 4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfinyl]butyl 4-methylbenzenesulfonate.
| Compound Name | 4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfinyl]butyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 150014079 |
| Molecular Formula | C24H26N2O7S2 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | 4-[[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]sulfinyl]butyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCS(=O)c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C24H26N2O7S2/c1-16-7-9-17(10-8-16)35(31,32)33-13-2-3-14-34(30)21-6-4-5-18-19(21)15-26(24(18)29)20-11-12-22(27)25-23(20)28/h4-10,20H,2-3,11-15H2,1H3,(H,25,27,28) |
| InChIKey | DDWUNIDQGTYLAC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|