C27H32N2O4 — CID 141341745
3-[7-(4-octoxyphenyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 141341745) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 3-[7-(4-octoxyphenyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[7-(4-octoxyphenyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 141341745 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 3-[7-(4-octoxyphenyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CCCCCCCCOc1ccc(-c2cccc3c2CN(C2CCC(=O)NC2=O)C3=O)cc1 |
| InChI | InChI=1S/C27H32N2O4/c1-2-3-4-5-6-7-17-33-20-13-11-19(12-14-20)21-9-8-10-22-23(21)18-29(27(22)32)24-15-16-25(30)28-26(24)31/h8-14,24H,2-7,15-18H2,1H3,(H,28,30,31) |
| InChIKey | QHTDKGBLURKORV-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|