C19H22BFN2O5 — CID 169206397
3-[4-fluoro-3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 169206397) has the molecular formula C19H22BFN2O5 and a molecular weight of 388.20 g/mol. Its IUPAC name is 3-[4-fluoro-3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-fluoro-3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 169206397 |
| Molecular Formula | C19H22BFN2O5 |
| Molecular Weight | 388.20 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 3-[4-fluoro-3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1(C)OB(c2cc(F)c3c(c2)CN(C2CCC(=O)NC2=O)C3=O)OC1(C)C |
| InChI | InChI=1S/C19H22BFN2O5/c1-18(2)19(3,4)28-20(27-18)11-7-10-9-23(17(26)15(10)12(21)8-11)13-5-6-14(24)22-16(13)25/h7-8,13H,5-6,9H2,1-4H3,(H,22,24,25) |
| InChIKey | GTIHMUMSJPFAQU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|