C14H13BrN2O5S — CID 167342393
3-(4-bromo-6-methylsulfonyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (PubChem CID 167342393) has the molecular formula C14H13BrN2O5S and a molecular weight of 401.24 g/mol. Its IUPAC name is 3-(4-bromo-6-methylsulfonyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(4-bromo-6-methylsulfonyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 167342393 |
| Molecular Formula | C14H13BrN2O5S |
| Molecular Weight | 401.24 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 3-(4-bromo-6-methylsulfonyl-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| SMILES | CS(=O)(=O)c1cc(Br)c2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C14H13BrN2O5S/c1-23(21,22)8-4-7-6-17(14(20)12(7)9(15)5-8)10-2-3-11(18)16-13(10)19/h4-5,10H,2-3,6H2,1H3,(H,16,18,19) |
| InChIKey | JXCCSBBBMQCIAT-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.24 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|