C14H12Br2N2O3 — CID 168871651
3-[4-bromo-5-(bromomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 168871651) has the molecular formula C14H12Br2N2O3 and a molecular weight of 416.07 g/mol. Its IUPAC name is 3-[4-bromo-5-(bromomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[4-bromo-5-(bromomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 168871651 |
| Molecular Formula | C14H12Br2N2O3 |
| Molecular Weight | 416.07 g/mol |
| Exact Mass | 413.92 |
| IUPAC Name | 3-[4-bromo-5-(bromomethyl)-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3ccc(CBr)c(Br)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C14H12Br2N2O3/c15-5-7-1-2-8-6-18(14(21)11(8)12(7)16)9-3-4-10(19)17-13(9)20/h1-2,9H,3-6H2,(H,17,19,20) |
| InChIKey | LEXRSTRNCPXXAN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.07 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|