C14H10ClN3O3 — CID 167342017
4-chloro-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonitrile (PubChem CID 167342017) has the molecular formula C14H10ClN3O3 and a molecular weight of 303.71 g/mol. Its IUPAC name is 4-chloro-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonitrile.
| Compound Name | 4-chloro-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonitrile |
|---|---|
| PubChem CID | 167342017 |
| Molecular Formula | C14H10ClN3O3 |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 4-chloro-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonitrile |
| SMILES | N#Cc1ccc2c(c1Cl)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C14H10ClN3O3/c15-12-7(5-16)1-2-8-6-18(14(21)11(8)12)9-3-4-10(19)17-13(9)20/h1-2,9H,3-4,6H2,(H,17,19,20) |
| InChIKey | ADMMZCLOGXPETN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|