C15H14N4O3 — CID 172602391
2-(2,6-dioxopiperidin-3-yl)-4-(methylamino)-1-oxo-3H-isoindole-5-carbonitrile (PubChem CID 172602391) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-4-(methylamino)-1-oxo-3H-isoindole-5-carbonitrile.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-4-(methylamino)-1-oxo-3H-isoindole-5-carbonitrile |
|---|---|
| PubChem CID | 172602391 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-4-(methylamino)-1-oxo-3H-isoindole-5-carbonitrile |
| SMILES | CNc1c(C#N)ccc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C15H14N4O3/c1-17-13-8(6-16)2-3-9-10(13)7-19(15(9)22)11-4-5-12(20)18-14(11)21/h2-3,11,17H,4-5,7H2,1H3,(H,18,20,21) |
| InChIKey | YTPJRDRVMMAZEE-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|