C16H16N4O3 — CID 167342181
7-(dimethylamino)-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonitrile (PubChem CID 167342181) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 7-(dimethylamino)-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonitrile.
| Compound Name | 7-(dimethylamino)-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonitrile |
|---|---|
| PubChem CID | 167342181 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 7-(dimethylamino)-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carbonitrile |
| SMILES | CN(C)c1cc(C#N)cc2c1CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C16H16N4O3/c1-19(2)13-6-9(7-17)5-10-11(13)8-20(16(10)23)12-3-4-14(21)18-15(12)22/h5-6,12H,3-4,8H2,1-2H3,(H,18,21,22) |
| InChIKey | QAJPKCUJBBAGJA-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 93.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|