C15H10F3N3O4 — CID 167342308
2-(2,6-dioxopiperidin-3-yl)-3-oxo-7-(trifluoromethoxy)-1H-isoindole-5-carbonitrile (PubChem CID 167342308) has the molecular formula C15H10F3N3O4 and a molecular weight of 353.26 g/mol. Its IUPAC name is 2-(2,6-dioxopiperidin-3-yl)-3-oxo-7-(trifluoromethoxy)-1H-isoindole-5-carbonitrile.
| Compound Name | 2-(2,6-dioxopiperidin-3-yl)-3-oxo-7-(trifluoromethoxy)-1H-isoindole-5-carbonitrile |
|---|---|
| PubChem CID | 167342308 |
| Molecular Formula | C15H10F3N3O4 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-3-oxo-7-(trifluoromethoxy)-1H-isoindole-5-carbonitrile |
| SMILES | N#Cc1cc(OC(F)(F)F)c2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C15H10F3N3O4/c16-15(17,18)25-11-4-7(5-19)3-8-9(11)6-21(14(8)24)10-1-2-12(22)20-13(10)23/h3-4,10H,1-2,6H2,(H,20,22,23) |
| InChIKey | JFBMEWNIXTXNCK-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|