C17H19IN4O4 — CID 156527826
2-(dimethylamino)-N-[2-(2,6-dioxopiperidin-3-yl)-7-iodo-3-oxo-1H-isoindol-5-yl]acetamide (PubChem CID 156527826) has the molecular formula C17H19IN4O4 and a molecular weight of 470.27 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[2-(2,6-dioxopiperidin-3-yl)-7-iodo-3-oxo-1H-isoindol-5-yl]acetamide.
| Compound Name | 2-(dimethylamino)-N-[2-(2,6-dioxopiperidin-3-yl)-7-iodo-3-oxo-1H-isoindol-5-yl]acetamide |
|---|---|
| PubChem CID | 156527826 |
| Molecular Formula | C17H19IN4O4 |
| Molecular Weight | 470.27 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | 2-(dimethylamino)-N-[2-(2,6-dioxopiperidin-3-yl)-7-iodo-3-oxo-1H-isoindol-5-yl]acetamide |
| SMILES | CN(C)CC(=O)Nc1cc(I)c2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C17H19IN4O4/c1-21(2)8-15(24)19-9-5-10-11(12(18)6-9)7-22(17(10)26)13-3-4-14(23)20-16(13)25/h5-6,13H,3-4,7-8H2,1-2H3,(H,19,24)(H,20,23,25) |
| InChIKey | UDZKUINRYDEMDI-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|