C15H13BrN2O5 — CID 166074332
methyl 7-bromo-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carboxylate (PubChem CID 166074332) has the molecular formula C15H13BrN2O5 and a molecular weight of 381.18 g/mol. Its IUPAC name is methyl 7-bromo-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carboxylate.
| Compound Name | methyl 7-bromo-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carboxylate |
|---|---|
| PubChem CID | 166074332 |
| Molecular Formula | C15H13BrN2O5 |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 380.00 |
| IUPAC Name | methyl 7-bromo-2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindole-5-carboxylate |
| SMILES | COC(=O)c1cc(Br)c2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2 |
| InChI | InChI=1S/C15H13BrN2O5/c1-23-15(22)7-4-8-9(10(16)5-7)6-18(14(8)21)11-2-3-12(19)17-13(11)20/h4-5,11H,2-3,6H2,1H3,(H,17,19,20) |
| InChIKey | XKRAEQMNQLYXES-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|