C22H18N6O5 — CID 167908357
methyl 5-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]pyridine-3-carboxylate (PubChem CID 167908357) has the molecular formula C22H18N6O5 and a molecular weight of 446.42 g/mol. Its IUPAC name is methyl 5-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]pyridine-3-carboxylate.
| Compound Name | methyl 5-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 167908357 |
| Molecular Formula | C22H18N6O5 |
| Molecular Weight | 446.42 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | methyl 5-[1-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-5-yl]triazol-4-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(-c2cn(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)c1 |
| InChI | InChI=1S/C22H18N6O5/c1-33-22(32)13-6-12(8-23-9-13)17-11-28(26-25-17)15-2-3-16-14(7-15)10-27(21(16)31)18-4-5-19(29)24-20(18)30/h2-3,6-9,11,18H,4-5,10H2,1H3,(H,24,29,30) |
| InChIKey | PFIMTIKUMXNGLO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 136.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|