C22H18ClN5O4 — CID 167791543
3-[6-[4-(4-chloro-3-methoxyphenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167791543) has the molecular formula C22H18ClN5O4 and a molecular weight of 451.87 g/mol. Its IUPAC name is 3-[6-[4-(4-chloro-3-methoxyphenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(4-chloro-3-methoxyphenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167791543 |
| Molecular Formula | C22H18ClN5O4 |
| Molecular Weight | 451.87 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 3-[6-[4-(4-chloro-3-methoxyphenyl)triazol-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | COc1cc(-c2cn(-c3ccc4c(c3)CN(C3CCC(=O)NC3=O)C4=O)nn2)ccc1Cl |
| InChI | InChI=1S/C22H18ClN5O4/c1-32-19-9-12(2-5-16(19)23)17-11-28(26-25-17)14-3-4-15-13(8-14)10-27(22(15)31)18-6-7-20(29)24-21(18)30/h2-5,8-9,11,18H,6-7,10H2,1H3,(H,24,29,30) |
| InChIKey | XGOIUZYDEPEVRK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.87 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|